About chloromethyl 2-methoxyethyl carbonate
chloromethyl 2-methoxyethyl carbonate (PubChem CID 18629498) has the molecular formula C5H9ClO4
and a molecular weight of 168.58 g/mol. Its IUPAC name is chloromethyl 2-methoxyethyl carbonate.
Molecular Properties
| Compound Name | chloromethyl 2-methoxyethyl carbonate |
| PubChem CID | 18629498 |
| Molecular Formula | C5H9ClO4 |
| Molecular Weight | 168.58 g/mol |
| Exact Mass | 168.02 |
| IUPAC Name | chloromethyl 2-methoxyethyl carbonate |
| SMILES | COCCOC(=O)OCCl |
| InChI | InChI=1S/C5H9ClO4/c1-8-2-3-9-5(7)10-4-6/h2-4H2,1H3 |
| InChIKey | XIQFQYLHQIVRSP-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.58 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze chloromethyl 2-methoxyethyl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of chloromethyl 2-methoxyethyl carbonate?
The IUPAC name of chloromethyl 2-methoxyethyl carbonate (CID 18629498) is chloromethyl 2-methoxyethyl carbonate.
What is the SMILES notation for chloromethyl 2-methoxyethyl carbonate?
The canonical SMILES for chloromethyl 2-methoxyethyl carbonate is COCCOC(=O)OCCl.
What is the InChIKey of chloromethyl 2-methoxyethyl carbonate?
The InChIKey is XIQFQYLHQIVRSP-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H9ClO4/c1-8-2-3-9-5(7)10-4-6/h2-4H2,1H3.
What are the key properties of chloromethyl 2-methoxyethyl carbonate?
chloromethyl 2-methoxyethyl carbonate has a molecular weight of 168.58 g/mol, XLogP of 0.98, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for chloromethyl 2-methoxyethyl carbonate is sourced from PubChem (CID 18629498), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).