C14H28O2 — CID 18629561
3-(2,2,6,7,7-pentamethyloctan-3-yl)dioxirane (PubChem CID 18629561) has the molecular formula C14H28O2 and a molecular weight of 228.38 g/mol. Its IUPAC name is 3-(2,2,6,7,7-pentamethyloctan-3-yl)dioxirane.
| Compound Name | 3-(2,2,6,7,7-pentamethyloctan-3-yl)dioxirane |
|---|---|
| PubChem CID | 18629561 |
| Molecular Formula | C14H28O2 |
| Molecular Weight | 228.38 g/mol |
| Exact Mass | 228.21 |
| IUPAC Name | 3-(2,2,6,7,7-pentamethyloctan-3-yl)dioxirane |
| SMILES | CC(CCC(C1OO1)C(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C14H28O2/c1-10(13(2,3)4)8-9-11(12-15-16-12)14(5,6)7/h10-12H,8-9H2,1-7H3 |
| InChIKey | ZBZGQBJZDRNQDT-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 25.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.38 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|