C45H65O3P — CID 18629588
bis(3,6,8-tritert-butylnaphthalen-2-yl)methyl dihydrogen phosphite (PubChem CID 18629588) has the molecular formula C45H65O3P and a molecular weight of 684.99 g/mol. Its IUPAC name is bis(3,6,8-tritert-butylnaphthalen-2-yl)methyl dihydrogen phosphite.
| Compound Name | bis(3,6,8-tritert-butylnaphthalen-2-yl)methyl dihydrogen phosphite |
|---|---|
| PubChem CID | 18629588 |
| Molecular Formula | C45H65O3P |
| Molecular Weight | 684.99 g/mol |
| Exact Mass | 684.47 |
| IUPAC Name | bis(3,6,8-tritert-butylnaphthalen-2-yl)methyl dihydrogen phosphite |
| SMILES | CC(C)(C)c1cc(C(C)(C)C)c2cc(C(OP(O)O)c3cc4c(C(C)(C)C)cc(C(C)(C)C)cc4cc3C(C)(C)C)c(C(C)(C)C)cc2c1 |
| InChI | InChI=1S/C45H65O3P/c1-40(2,3)29-19-27-21-35(42(7,8)9)33(25-31(27)37(23-29)44(13,14)15)39(48-49(46)47)34-26-32-28(22-36(34)43(10,11)12)20-30(41(4,5)6)24-38(32)45(16,17)18/h19-26,39,46-47H,1-18H3 |
| InChIKey | IMGUFITZFZLRDD-UHFFFAOYSA-N |
| XLogP | 13.10 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 684.99 |
| LogP ≤ 5 | 13.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|