C33H22BF20N — CID 18629591
dibutyl(methyl)azanium;tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide (PubChem CID 18629591) has the molecular formula C33H22BF20N and a molecular weight of 823.32 g/mol. Its IUPAC name is dibutyl(methyl)azanium;tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide.
| Compound Name | dibutyl(methyl)azanium;tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide |
|---|---|
| PubChem CID | 18629591 |
| Molecular Formula | C33H22BF20N |
| Molecular Weight | 823.32 g/mol |
| Exact Mass | 823.15 |
| IUPAC Name | dibutyl(methyl)azanium;tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide |
| SMILES | CCCC[NH+](C)CCCC.Fc1c(F)c(F)c([B-](c2c(F)c(F)c(F)c(F)c2F)(c2c(F)c(F)c(F)c(F)c2F)c2c(F)c(F)c(F)c(F)c2F)c(F)c1F |
| InChI | InChI=1S/C24BF20.C9H21N/c26-5-1(6(27)14(35)21(42)13(5)34)25(2-7(28)15(36)22(43)16(37)8(2)29,3-9(30)17(38)23(44)18(39)10(3)31)4-11(32)19(40)24(45)20(41)12(4)33;1-4-6-8-10(3)9-7-5-2/h;4-9H2,1-3H3/q-1;/p+1 |
| InChIKey | PJYNJEJDDPGAQB-UHFFFAOYSA-O |
| XLogP | 6.95 |
| TPSA | 4.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 10 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 823.32 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|