C5H3F7 — CID 18629941
1,1,2,3,4,4,4-heptafluoro-3-methylbut-1-ene (PubChem CID 18629941) has the molecular formula C5H3F7 and a molecular weight of 196.06 g/mol. Its IUPAC name is 1,1,2,3,4,4,4-heptafluoro-3-methylbut-1-ene.
| Compound Name | 1,1,2,3,4,4,4-heptafluoro-3-methylbut-1-ene |
|---|---|
| PubChem CID | 18629941 |
| Molecular Formula | C5H3F7 |
| Molecular Weight | 196.06 g/mol |
| Exact Mass | 196.01 |
| IUPAC Name | 1,1,2,3,4,4,4-heptafluoro-3-methylbut-1-ene |
| SMILES | CC(F)(C(F)=C(F)F)C(F)(F)F |
| InChI | InChI=1S/C5H3F7/c1-4(9,5(10,11)12)2(6)3(7)8/h1H3 |
| InChIKey | ADLOYHSTVBZNLC-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.06 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |