C23H39NO — CID 18630063
N,2,4,6-tetratert-butylbenzamide (PubChem CID 18630063) has the molecular formula C23H39NO and a molecular weight of 345.57 g/mol. Its IUPAC name is N,2,4,6-tetratert-butylbenzamide.
| Compound Name | N,2,4,6-tetratert-butylbenzamide |
|---|---|
| PubChem CID | 18630063 |
| Molecular Formula | C23H39NO |
| Molecular Weight | 345.57 g/mol |
| Exact Mass | 345.30 |
| IUPAC Name | N,2,4,6-tetratert-butylbenzamide |
| SMILES | CC(C)(C)NC(=O)c1c(C(C)(C)C)cc(C(C)(C)C)cc1C(C)(C)C |
| InChI | InChI=1S/C23H39NO/c1-20(2,3)15-13-16(21(4,5)6)18(17(14-15)22(7,8)9)19(25)24-23(10,11)12/h13-14H,1-12H3,(H,24,25) |
| InChIKey | WYRGNZXWKJFTNH-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.57 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |