About N-(2,4,6-tritert-butylphenyl)acetamide
N-(2,4,6-tritert-butylphenyl)acetamide (PubChem CID 18630349) has the molecular formula C20H33NO
and a molecular weight of 303.49 g/mol. Its IUPAC name is N-(2,4,6-tritert-butylphenyl)acetamide.
Molecular Properties
| Compound Name | N-(2,4,6-tritert-butylphenyl)acetamide |
| PubChem CID | 18630349 |
| Molecular Formula | C20H33NO |
| Molecular Weight | 303.49 g/mol |
| Exact Mass | 303.26 |
| IUPAC Name | N-(2,4,6-tritert-butylphenyl)acetamide |
| SMILES | CC(=O)Nc1c(C(C)(C)C)cc(C(C)(C)C)cc1C(C)(C)C |
| InChI | InChI=1S/C20H33NO/c1-13(22)21-17-15(19(5,6)7)11-14(18(2,3)4)12-16(17)20(8,9)10/h11-12H,1-10H3,(H,21,22) |
| InChIKey | OSIMQUOPJUILLV-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 303.49 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N-(2,4,6-tritert-butylphenyl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2,4,6-tritert-butylphenyl)acetamide?
The IUPAC name of N-(2,4,6-tritert-butylphenyl)acetamide (CID 18630349) is N-(2,4,6-tritert-butylphenyl)acetamide.
What is the SMILES notation for N-(2,4,6-tritert-butylphenyl)acetamide?
The canonical SMILES for N-(2,4,6-tritert-butylphenyl)acetamide is CC(=O)Nc1c(C(C)(C)C)cc(C(C)(C)C)cc1C(C)(C)C.
What is the InChIKey of N-(2,4,6-tritert-butylphenyl)acetamide?
The InChIKey is OSIMQUOPJUILLV-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H33NO/c1-13(22)21-17-15(19(5,6)7)11-14(18(2,3)4)12-16(17)20(8,9)10/h11-12H,1-10H3,(H,21,22).
What are the key properties of N-(2,4,6-tritert-butylphenyl)acetamide?
N-(2,4,6-tritert-butylphenyl)acetamide has a molecular weight of 303.49 g/mol, XLogP of 5.54, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2,4,6-tritert-butylphenyl)acetamide is sourced from PubChem (CID 18630349), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).