About S-[2-[[(2S)-2-aminopropanoyl]amino]ethyl] ethanethioate;hydrobromide
S-[2-[[(2S)-2-aminopropanoyl]amino]ethyl] ethanethioate;hydrobromide (PubChem CID 18631475) has the molecular formula C7H15BrN2O2S
and a molecular weight of 271.18 g/mol. Its IUPAC name is S-[2-[[(2S)-2-aminopropanoyl]amino]ethyl] ethanethioate;hydrobromide.
Molecular Properties
| Compound Name | S-[2-[[(2S)-2-aminopropanoyl]amino]ethyl] ethanethioate;hydrobromide |
| PubChem CID | 18631475 |
| Molecular Formula | C7H15BrN2O2S |
| Molecular Weight | 271.18 g/mol |
| Exact Mass | 270.00 |
| IUPAC Name | S-[2-[[(2S)-2-aminopropanoyl]amino]ethyl] ethanethioate;hydrobromide |
| SMILES | Br.CC(=O)SCCNC(=O)[C@H](C)N |
| InChI | InChI=1S/C7H14N2O2S.BrH/c1-5(8)7(11)9-3-4-12-6(2)10;/h5H,3-4,8H2,1-2H3,(H,9,11);1H/t5-;/m0./s1 |
| InChIKey | HGMSRLBPMSJGGS-JEDNCBNOSA-N |
| XLogP | 0.31 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.18 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-[2-[[(2S)-2-aminopropanoyl]amino]ethyl] ethanethioate;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-[2-[[(2S)-2-aminopropanoyl]amino]ethyl] ethanethioate;hydrobromide?
The IUPAC name of S-[2-[[(2S)-2-aminopropanoyl]amino]ethyl] ethanethioate;hydrobromide (CID 18631475) is S-[2-[[(2S)-2-aminopropanoyl]amino]ethyl] ethanethioate;hydrobromide.
What is the SMILES notation for S-[2-[[(2S)-2-aminopropanoyl]amino]ethyl] ethanethioate;hydrobromide?
The canonical SMILES for S-[2-[[(2S)-2-aminopropanoyl]amino]ethyl] ethanethioate;hydrobromide is Br.CC(=O)SCCNC(=O)[C@H](C)N.
What is the InChIKey of S-[2-[[(2S)-2-aminopropanoyl]amino]ethyl] ethanethioate;hydrobromide?
The InChIKey is HGMSRLBPMSJGGS-JEDNCBNOSA-N. The full InChI is InChI=1S/C7H14N2O2S.BrH/c1-5(8)7(11)9-3-4-12-6(2)10;/h5H,3-4,8H2,1-2H3,(H,9,11);1H/t5-;/m0./s1.
What are the key properties of S-[2-[[(2S)-2-aminopropanoyl]amino]ethyl] ethanethioate;hydrobromide?
S-[2-[[(2S)-2-aminopropanoyl]amino]ethyl] ethanethioate;hydrobromide has a molecular weight of 271.18 g/mol, XLogP of 0.31, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for S-[2-[[(2S)-2-aminopropanoyl]amino]ethyl] ethanethioate;hydrobromide is sourced from PubChem (CID 18631475), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).