C9H15F3N2O4S — CID 18631476
S-[2-[[(2S)-2-aminopropanoyl]amino]ethyl] ethanethioate;2,2,2-trifluoroacetic acid (PubChem CID 18631476) has the molecular formula C9H15F3N2O4S and a molecular weight of 304.29 g/mol. Its IUPAC name is S-[2-[[(2S)-2-aminopropanoyl]amino]ethyl] ethanethioate;2,2,2-trifluoroacetic acid.
| Compound Name | S-[2-[[(2S)-2-aminopropanoyl]amino]ethyl] ethanethioate;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 18631476 |
| Molecular Formula | C9H15F3N2O4S |
| Molecular Weight | 304.29 g/mol |
| Exact Mass | 304.07 |
| IUPAC Name | S-[2-[[(2S)-2-aminopropanoyl]amino]ethyl] ethanethioate;2,2,2-trifluoroacetic acid |
| SMILES | CC(=O)SCCNC(=O)[C@H](C)N.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C7H14N2O2S.C2HF3O2/c1-5(8)7(11)9-3-4-12-6(2)10;3-2(4,5)1(6)7/h5H,3-4,8H2,1-2H3,(H,9,11);(H,6,7)/t5-;/m0./s1 |
| InChIKey | IPTMVQLGEBQCLR-JEDNCBNOSA-N |
| XLogP | 0.36 |
| TPSA | 109.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.29 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|