C9H18O4S — CID 18631732
(2R,3S,4S)-2,3,4-trihydroxy-5-(2-methylpropylsulfanyl)pentanal (PubChem CID 18631732) has the molecular formula C9H18O4S and a molecular weight of 222.31 g/mol. Its IUPAC name is (2R,3S,4S)-2,3,4-trihydroxy-5-(2-methylpropylsulfanyl)pentanal.
| Compound Name | (2R,3S,4S)-2,3,4-trihydroxy-5-(2-methylpropylsulfanyl)pentanal |
|---|---|
| PubChem CID | 18631732 |
| Molecular Formula | C9H18O4S |
| Molecular Weight | 222.31 g/mol |
| Exact Mass | 222.09 |
| IUPAC Name | (2R,3S,4S)-2,3,4-trihydroxy-5-(2-methylpropylsulfanyl)pentanal |
| SMILES | CC(C)CSC[C@@H](O)[C@@H](O)[C@@H](O)C=O |
| InChI | InChI=1S/C9H18O4S/c1-6(2)4-14-5-8(12)9(13)7(11)3-10/h3,6-9,11-13H,4-5H2,1-2H3/t7-,8+,9-/m0/s1 |
| InChIKey | YRYSTVYVSOLNOU-YIZRAAEISA-N |
| XLogP | -0.34 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.31 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|