C19H24O14S — CID 18631996
acetyl (2R,3S,4S,5S)-3,4-diacetyloxy-2,3,4,5,6-pentahydroxy-6-(4-methylphenyl)sulfonylhexanoate (PubChem CID 18631996) has the molecular formula C19H24O14S and a molecular weight of 508.45 g/mol. Its IUPAC name is acetyl (2R,3S,4S,5S)-3,4-diacetyloxy-2,3,4,5,6-pentahydroxy-6-(4-methylphenyl)sulfonylhexanoate.
| Compound Name | acetyl (2R,3S,4S,5S)-3,4-diacetyloxy-2,3,4,5,6-pentahydroxy-6-(4-methylphenyl)sulfonylhexanoate |
|---|---|
| PubChem CID | 18631996 |
| Molecular Formula | C19H24O14S |
| Molecular Weight | 508.45 g/mol |
| Exact Mass | 508.09 |
| IUPAC Name | acetyl (2R,3S,4S,5S)-3,4-diacetyloxy-2,3,4,5,6-pentahydroxy-6-(4-methylphenyl)sulfonylhexanoate |
| SMILES | CC(=O)OC(=O)[C@H](O)[C@](O)(OC(C)=O)[C@@](O)(OC(C)=O)[C@H](O)C(O)S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C19H24O14S/c1-9-5-7-13(8-6-9)34(29,30)17(26)15(24)19(28,33-12(4)22)18(27,32-11(3)21)14(23)16(25)31-10(2)20/h5-8,14-15,17,23-24,26-28H,1-4H3/t14-,15+,17?,18-,19-/m0/s1 |
| InChIKey | NAEUMXSHTQRYIQ-CQSBONJFSA-N |
| XLogP | -2.60 |
| TPSA | 231.26 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.45 |
| LogP ≤ 5 | -2.60 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|