C26H46N2O6 — CID 18632419
trans-(1S,2S)-1,2-bis(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl)cyclohexane-1,4-dicarboxylic acid (PubChem CID 18632419) has the molecular formula C26H46N2O6 and a molecular weight of 482.66 g/mol. Its IUPAC name is trans-(1S,2S)-1,2-bis(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl)cyclohexane-1,4-dicarboxylic acid.
| Compound Name | trans-(1S,2S)-1,2-bis(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl)cyclohexane-1,4-dicarboxylic acid |
|---|---|
| PubChem CID | 18632419 |
| Molecular Formula | C26H46N2O6 |
| Molecular Weight | 482.66 g/mol |
| Exact Mass | 482.34 |
| IUPAC Name | trans-(1S,2S)-1,2-bis(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl)cyclohexane-1,4-dicarboxylic acid |
| SMILES | CC1(C)CC([C@@H]2CC(C(=O)O)CC[C@]2(C(=O)O)C2CC(C)(C)N(O)C(C)(C)C2)CC(C)(C)N1O |
| InChI | InChI=1S/C26H46N2O6/c1-22(2)12-17(13-23(3,4)27(22)33)19-11-16(20(29)30)9-10-26(19,21(31)32)18-14-24(5,6)28(34)25(7,8)15-18/h16-19,33-34H,9-15H2,1-8H3,(H,29,30)(H,31,32)/t16?,19-,26-/m0/s1 |
| InChIKey | IXFHDVXSQIYGTL-AQGMDSIOSA-N |
| XLogP | 4.88 |
| TPSA | 121.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.66 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |