C50H50Cl6N2O6 — CID 18632616
4,5,6,7-tetrachloro-3,3-bis[(E)-2-[2-(3-chloropropylamino)-4-ethylphenyl]-2-(3,4-dimethoxyphenyl)ethenyl]-2-benzofuran-1-one (PubChem CID 18632616) has the molecular formula C50H50Cl6N2O6 and a molecular weight of 987.68 g/mol. Its IUPAC name is 4,5,6,7-tetrachloro-3,3-bis[(E)-2-[2-(3-chloropropylamino)-4-ethylphenyl]-2-(3,4-dimethoxyphenyl)ethenyl]-2-benzofuran-1-one.
| Compound Name | 4,5,6,7-tetrachloro-3,3-bis[(E)-2-[2-(3-chloropropylamino)-4-ethylphenyl]-2-(3,4-dimethoxyphenyl)ethenyl]-2-benzofuran-1-one |
|---|---|
| PubChem CID | 18632616 |
| Molecular Formula | C50H50Cl6N2O6 |
| Molecular Weight | 987.68 g/mol |
| Exact Mass | 984.18 |
| IUPAC Name | 4,5,6,7-tetrachloro-3,3-bis[(E)-2-[2-(3-chloropropylamino)-4-ethylphenyl]-2-(3,4-dimethoxyphenyl)ethenyl]-2-benzofuran-1-one |
| SMILES | CCc1ccc(/C(=C/C2(/C=C(\c3ccc(OC)c(OC)c3)c3ccc(CC)cc3NCCCCl)OC(=O)c3c(Cl)c(Cl)c(Cl)c(Cl)c32)c2ccc(OC)c(OC)c2)c(NCCCCl)c1 |
| InChI | InChI=1S/C50H50Cl6N2O6/c1-7-29-11-15-33(37(23-29)57-21-9-19-51)35(31-13-17-39(60-3)41(25-31)62-5)27-50(44-43(49(59)64-50)45(53)47(55)48(56)46(44)54)28-36(32-14-18-40(61-4)42(26-32)63-6)34-16-12-30(8-2)24-38(34)58-22-10-20-52/h11-18,23-28,57-58H,7-10,19-22H2,1-6H3/b35-27+,36-28+ |
| InChIKey | SYVCOFXINUIOLN-JEVCVBCSSA-N |
| XLogP | 14.17 |
| TPSA | 87.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 987.68 |
| LogP ≤ 5 | 14.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|