C23H42O4Si — CID 18632728
2-[(3aR,7aR)-1-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-(oxan-2-yloxy)-2,3,3a,6,7,7a-hexahydro-1H-inden-5-yl]ethanol (PubChem CID 18632728) has the molecular formula C23H42O4Si and a molecular weight of 410.67 g/mol. Its IUPAC name is 2-[(3aR,7aR)-1-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-(oxan-2-yloxy)-2,3,3a,6,7,7a-hexahydro-1H-inden-5-yl]ethanol.
| Compound Name | 2-[(3aR,7aR)-1-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-(oxan-2-yloxy)-2,3,3a,6,7,7a-hexahydro-1H-inden-5-yl]ethanol |
|---|---|
| PubChem CID | 18632728 |
| Molecular Formula | C23H42O4Si |
| Molecular Weight | 410.67 g/mol |
| Exact Mass | 410.29 |
| IUPAC Name | 2-[(3aR,7aR)-1-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-(oxan-2-yloxy)-2,3,3a,6,7,7a-hexahydro-1H-inden-5-yl]ethanol |
| SMILES | CC(C)(C)[Si](C)(C)OCC1C(OC2CCCCO2)C[C@H]2C=C(CCO)CC[C@@H]12 |
| InChI | InChI=1S/C23H42O4Si/c1-23(2,3)28(4,5)26-16-20-19-10-9-17(11-12-24)14-18(19)15-21(20)27-22-8-6-7-13-25-22/h14,18-22,24H,6-13,15-16H2,1-5H3/t18-,19-,20?,21?,22?/m1/s1 |
| InChIKey | QTKBSNMHHGJNIX-ZZDYOGERSA-N |
| XLogP | 5.27 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.67 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|