C25H44O4Si — CID 18632749
[(3aR,7aR)-2-(oxan-2-yloxy)-5-(prop-2-enoxymethyl)-2,3,3a,6,7,7a-hexahydro-1H-inden-1-yl]methoxy-tert-butyl-dimethylsilane (PubChem CID 18632749) has the molecular formula C25H44O4Si and a molecular weight of 436.71 g/mol. Its IUPAC name is [(3aR,7aR)-2-(oxan-2-yloxy)-5-(prop-2-enoxymethyl)-2,3,3a,6,7,7a-hexahydro-1H-inden-1-yl]methoxy-tert-butyl-dimethylsilane.
| Compound Name | [(3aR,7aR)-2-(oxan-2-yloxy)-5-(prop-2-enoxymethyl)-2,3,3a,6,7,7a-hexahydro-1H-inden-1-yl]methoxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 18632749 |
| Molecular Formula | C25H44O4Si |
| Molecular Weight | 436.71 g/mol |
| Exact Mass | 436.30 |
| IUPAC Name | [(3aR,7aR)-2-(oxan-2-yloxy)-5-(prop-2-enoxymethyl)-2,3,3a,6,7,7a-hexahydro-1H-inden-1-yl]methoxy-tert-butyl-dimethylsilane |
| SMILES | C=CCOCC1=C[C@@H]2CC(OC3CCCCO3)C(CO[Si](C)(C)C(C)(C)C)[C@@H]2CC1 |
| InChI | InChI=1S/C25H44O4Si/c1-7-13-26-17-19-11-12-21-20(15-19)16-23(29-24-10-8-9-14-27-24)22(21)18-28-30(5,6)25(2,3)4/h7,15,20-24H,1,8-14,16-18H2,2-6H3/t20-,21-,22?,23?,24?/m1/s1 |
| InChIKey | DIDVYQNBQCBYSA-HOVSISLESA-N |
| XLogP | 6.10 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.71 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|