C10H17NO2Si — CID 18633014
(3R,4S)-3-[(1R)-1-hydroxyethyl]-4-(2-trimethylsilylethynyl)azetidin-2-one (PubChem CID 18633014) has the molecular formula C10H17NO2Si and a molecular weight of 211.34 g/mol. Its IUPAC name is (3R,4S)-3-[(1R)-1-hydroxyethyl]-4-(2-trimethylsilylethynyl)azetidin-2-one.
| Compound Name | (3R,4S)-3-[(1R)-1-hydroxyethyl]-4-(2-trimethylsilylethynyl)azetidin-2-one |
|---|---|
| PubChem CID | 18633014 |
| Molecular Formula | C10H17NO2Si |
| Molecular Weight | 211.34 g/mol |
| Exact Mass | 211.10 |
| IUPAC Name | (3R,4S)-3-[(1R)-1-hydroxyethyl]-4-(2-trimethylsilylethynyl)azetidin-2-one |
| SMILES | C[C@@H](O)[C@@H]1C(=O)N[C@@H]1C#C[Si](C)(C)C |
| InChI | InChI=1S/C10H17NO2Si/c1-7(12)9-8(11-10(9)13)5-6-14(2,3)4/h7-9,12H,1-4H3,(H,11,13)/t7-,8-,9+/m1/s1 |
| InChIKey | JNUKXXBVUJDUDV-HLTSFMKQSA-N |
| XLogP | 0.36 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.34 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|