C23H23N3O6 — CID 18633384
N-[[(2R,3S,5R)-5-(5-ethyl-2,4-dioxopyrimidin-1-yl)-3-hydroxyoxolan-2-yl]methyl]-2-formylnaphthalene-1-carboxamide (PubChem CID 18633384) has the molecular formula C23H23N3O6 and a molecular weight of 437.45 g/mol. Its IUPAC name is N-[[(2R,3S,5R)-5-(5-ethyl-2,4-dioxopyrimidin-1-yl)-3-hydroxyoxolan-2-yl]methyl]-2-formylnaphthalene-1-carboxamide.
| Compound Name | N-[[(2R,3S,5R)-5-(5-ethyl-2,4-dioxopyrimidin-1-yl)-3-hydroxyoxolan-2-yl]methyl]-2-formylnaphthalene-1-carboxamide |
|---|---|
| PubChem CID | 18633384 |
| Molecular Formula | C23H23N3O6 |
| Molecular Weight | 437.45 g/mol |
| Exact Mass | 437.16 |
| IUPAC Name | N-[[(2R,3S,5R)-5-(5-ethyl-2,4-dioxopyrimidin-1-yl)-3-hydroxyoxolan-2-yl]methyl]-2-formylnaphthalene-1-carboxamide |
| SMILES | CCc1cn([C@H]2C[C@H](O)[C@@H](CNC(=O)c3c(C=O)ccc4ccccc34)O2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C23H23N3O6/c1-2-13-11-26(23(31)25-21(13)29)19-9-17(28)18(32-19)10-24-22(30)20-15(12-27)8-7-14-5-3-4-6-16(14)20/h3-8,11-12,17-19,28H,2,9-10H2,1H3,(H,24,30)(H,25,29,31)/t17-,18+,19+/m0/s1 |
| InChIKey | HIQPMWCTDMZJKF-IPMKNSEASA-N |
| XLogP | 1.14 |
| TPSA | 130.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.45 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|