About 14,14-dichloro-3,11-bis(4-pentoxycyclohexyl)dispiro[5.1.58.16]tetradecane
14,14-dichloro-3,11-bis(4-pentoxycyclohexyl)dispiro[5.1.58.16]tetradecane (PubChem CID 18633552) has the molecular formula C36H62Cl2O2
and a molecular weight of 597.80 g/mol. Its IUPAC name is 14,14-dichloro-3,11-bis(4-pentoxycyclohexyl)dispiro[5.1.58.16]tetradecane.
Molecular Properties
| Compound Name | 14,14-dichloro-3,11-bis(4-pentoxycyclohexyl)dispiro[5.1.58.16]tetradecane |
| PubChem CID | 18633552 |
| Molecular Formula | C36H62Cl2O2 |
| Molecular Weight | 597.80 g/mol |
| Exact Mass | 596.41 |
| IUPAC Name | 14,14-dichloro-3,11-bis(4-pentoxycyclohexyl)dispiro[5.1.58.16]tetradecane |
| SMILES | CCCCCOC1CCC(C2CCC3(CC2)CC2(CCC(C4CCC(OCCCCC)CC4)CC2)C3(Cl)Cl)CC1 |
| InChI | InChI=1S/C36H62Cl2O2/c1-3-5-7-25-39-32-13-9-28(10-14-32)30-17-21-34(22-18-30)27-35(36(34,37)38)23-19-31(20-24-35)29-11-15-33(16-12-29)40-26-8-6-4-2/h28-33H,3-27H2,1-2H3 |
| InChIKey | RKZWNGCYJCJMQS-UHFFFAOYSA-N |
| XLogP | 11.45 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 597.80 |
| LogP ≤ 5 | 11.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 14,14-dichloro-3,11-bis(4-pentoxycyclohexyl)dispiro[5.1.58.16]tetradecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 14,14-dichloro-3,11-bis(4-pentoxycyclohexyl)dispiro[5.1.58.16]tetradecane?
The IUPAC name of 14,14-dichloro-3,11-bis(4-pentoxycyclohexyl)dispiro[5.1.58.16]tetradecane (CID 18633552) is 14,14-dichloro-3,11-bis(4-pentoxycyclohexyl)dispiro[5.1.58.16]tetradecane.
What is the SMILES notation for 14,14-dichloro-3,11-bis(4-pentoxycyclohexyl)dispiro[5.1.58.16]tetradecane?
The canonical SMILES for 14,14-dichloro-3,11-bis(4-pentoxycyclohexyl)dispiro[5.1.58.16]tetradecane is CCCCCOC1CCC(C2CCC3(CC2)CC2(CCC(C4CCC(OCCCCC)CC4)CC2)C3(Cl)Cl)CC1.
What is the InChIKey of 14,14-dichloro-3,11-bis(4-pentoxycyclohexyl)dispiro[5.1.58.16]tetradecane?
The InChIKey is RKZWNGCYJCJMQS-UHFFFAOYSA-N. The full InChI is InChI=1S/C36H62Cl2O2/c1-3-5-7-25-39-32-13-9-28(10-14-32)30-17-21-34(22-18-30)27-35(36(34,37)38)23-19-31(20-24-35)29-11-15-33(16-12-29)40-26-8-6-4-2/h28-33H,3-27H2,1-2H3.
What are the key properties of 14,14-dichloro-3,11-bis(4-pentoxycyclohexyl)dispiro[5.1.58.16]tetradecane?
14,14-dichloro-3,11-bis(4-pentoxycyclohexyl)dispiro[5.1.58.16]tetradecane has a molecular weight of 597.80 g/mol, XLogP of 11.45, 12 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 14,14-dichloro-3,11-bis(4-pentoxycyclohexyl)dispiro[5.1.58.16]tetradecane is sourced from PubChem (CID 18633552), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).