C18H32INO3 — CID 18634272
tert-butyl (4S,5R)-4-(cyclohexylmethyl)-5-(iodomethyl)-2,2-dimethyl-1,3-oxazolidine-3-carboxylate (PubChem CID 18634272) has the molecular formula C18H32INO3 and a molecular weight of 437.36 g/mol. Its IUPAC name is tert-butyl (4S,5R)-4-(cyclohexylmethyl)-5-(iodomethyl)-2,2-dimethyl-1,3-oxazolidine-3-carboxylate.
| Compound Name | tert-butyl (4S,5R)-4-(cyclohexylmethyl)-5-(iodomethyl)-2,2-dimethyl-1,3-oxazolidine-3-carboxylate |
|---|---|
| PubChem CID | 18634272 |
| Molecular Formula | C18H32INO3 |
| Molecular Weight | 437.36 g/mol |
| Exact Mass | 437.14 |
| IUPAC Name | tert-butyl (4S,5R)-4-(cyclohexylmethyl)-5-(iodomethyl)-2,2-dimethyl-1,3-oxazolidine-3-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1[C@@H](CC2CCCCC2)[C@H](CI)OC1(C)C |
| InChI | InChI=1S/C18H32INO3/c1-17(2,3)23-16(21)20-14(11-13-9-7-6-8-10-13)15(12-19)22-18(20,4)5/h13-15H,6-12H2,1-5H3/t14-,15-/m0/s1 |
| InChIKey | ODDSOGOOIXDWOZ-GJZGRUSLSA-N |
| XLogP | 5.13 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.36 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|