C21H28Cl4N2O4 — CID 18634335
N-[(1R,2R,4R,5S)-4,5-dimethoxy-2-pyrrolidin-1-ylcyclohexyl]-N-methyl-2-(2,3,4,5-tetrachlorophenoxy)acetamide (PubChem CID 18634335) has the molecular formula C21H28Cl4N2O4 and a molecular weight of 514.28 g/mol. Its IUPAC name is N-[(1R,2R,4R,5S)-4,5-dimethoxy-2-pyrrolidin-1-ylcyclohexyl]-N-methyl-2-(2,3,4,5-tetrachlorophenoxy)acetamide.
| Compound Name | N-[(1R,2R,4R,5S)-4,5-dimethoxy-2-pyrrolidin-1-ylcyclohexyl]-N-methyl-2-(2,3,4,5-tetrachlorophenoxy)acetamide |
|---|---|
| PubChem CID | 18634335 |
| Molecular Formula | C21H28Cl4N2O4 |
| Molecular Weight | 514.28 g/mol |
| Exact Mass | 512.08 |
| IUPAC Name | N-[(1R,2R,4R,5S)-4,5-dimethoxy-2-pyrrolidin-1-ylcyclohexyl]-N-methyl-2-(2,3,4,5-tetrachlorophenoxy)acetamide |
| SMILES | CO[C@H]1C[C@@H](N(C)C(=O)COc2cc(Cl)c(Cl)c(Cl)c2Cl)[C@H](N2CCCC2)C[C@H]1OC |
| InChI | InChI=1S/C21H28Cl4N2O4/c1-26(18(28)11-31-17-8-12(22)19(23)21(25)20(17)24)13-9-15(29-2)16(30-3)10-14(13)27-6-4-5-7-27/h8,13-16H,4-7,9-11H2,1-3H3/t13-,14-,15+,16-/m1/s1 |
| InChIKey | OGTYPQHKJOOBJC-LVQVYYBASA-N |
| XLogP | 4.79 |
| TPSA | 51.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.28 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|