C10H14BrNO4S — CID 18634352
(2R,5R,6R)-2-bromo-6-[(1R)-1-hydroxyethyl]-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid (PubChem CID 18634352) has the molecular formula C10H14BrNO4S and a molecular weight of 324.20 g/mol. Its IUPAC name is (2R,5R,6R)-2-bromo-6-[(1R)-1-hydroxyethyl]-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid.
| Compound Name | (2R,5R,6R)-2-bromo-6-[(1R)-1-hydroxyethyl]-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid |
|---|---|
| PubChem CID | 18634352 |
| Molecular Formula | C10H14BrNO4S |
| Molecular Weight | 324.20 g/mol |
| Exact Mass | 322.98 |
| IUPAC Name | (2R,5R,6R)-2-bromo-6-[(1R)-1-hydroxyethyl]-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid |
| SMILES | C[C@@H](O)[C@@H]1C(=O)N2[C@@H]1SC(C)(C)[C@]2(Br)C(=O)O |
| InChI | InChI=1S/C10H14BrNO4S/c1-4(13)5-6(14)12-7(5)17-9(2,3)10(12,11)8(15)16/h4-5,7,13H,1-3H3,(H,15,16)/t4-,5-,7-,10+/m1/s1 |
| InChIKey | JDYUWDYMCKUATH-FWRUNUBUSA-N |
| XLogP | 0.85 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.20 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|