C7H10O7 — CID 18634355
(2S,3R,3aR,7R,7aR)-2,3,3a,7-tetrahydroxy-3,6,7,7a-tetrahydro-2H-furo[3,2-c]pyran-4-one (PubChem CID 18634355) has the molecular formula C7H10O7 and a molecular weight of 206.15 g/mol. Its IUPAC name is (2S,3R,3aR,7R,7aR)-2,3,3a,7-tetrahydroxy-3,6,7,7a-tetrahydro-2H-furo[3,2-c]pyran-4-one.
| Compound Name | (2S,3R,3aR,7R,7aR)-2,3,3a,7-tetrahydroxy-3,6,7,7a-tetrahydro-2H-furo[3,2-c]pyran-4-one |
|---|---|
| PubChem CID | 18634355 |
| Molecular Formula | C7H10O7 |
| Molecular Weight | 206.15 g/mol |
| Exact Mass | 206.04 |
| IUPAC Name | (2S,3R,3aR,7R,7aR)-2,3,3a,7-tetrahydroxy-3,6,7,7a-tetrahydro-2H-furo[3,2-c]pyran-4-one |
| SMILES | O=C1OC[C@@H](O)[C@H]2O[C@H](O)[C@H](O)[C@]12O |
| InChI | InChI=1S/C7H10O7/c8-2-1-13-6(11)7(12)3(9)5(10)14-4(2)7/h2-5,8-10,12H,1H2/t2-,3+,4-,5+,7-/m1/s1 |
| InChIKey | FCWQBAHLBXRHSH-LNHNIDQWSA-N |
| XLogP | -3.29 |
| TPSA | 116.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.15 |
| LogP ≤ 5 | -3.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |