C17H25FO5 — CID 18634439
[(1S,2R,3R,4R)-2-fluoro-3-(methoxymethoxy)-4-(methoxymethoxymethyl)cyclopentyl]oxymethylbenzene (PubChem CID 18634439) has the molecular formula C17H25FO5 and a molecular weight of 328.38 g/mol. Its IUPAC name is [(1S,2R,3R,4R)-2-fluoro-3-(methoxymethoxy)-4-(methoxymethoxymethyl)cyclopentyl]oxymethylbenzene.
| Compound Name | [(1S,2R,3R,4R)-2-fluoro-3-(methoxymethoxy)-4-(methoxymethoxymethyl)cyclopentyl]oxymethylbenzene |
|---|---|
| PubChem CID | 18634439 |
| Molecular Formula | C17H25FO5 |
| Molecular Weight | 328.38 g/mol |
| Exact Mass | 328.17 |
| IUPAC Name | [(1S,2R,3R,4R)-2-fluoro-3-(methoxymethoxy)-4-(methoxymethoxymethyl)cyclopentyl]oxymethylbenzene |
| SMILES | COCOC[C@H]1C[C@H](OCc2ccccc2)[C@@H](F)[C@@H]1OCOC |
| InChI | InChI=1S/C17H25FO5/c1-19-11-21-10-14-8-15(16(18)17(14)23-12-20-2)22-9-13-6-4-3-5-7-13/h3-7,14-17H,8-12H2,1-2H3/t14-,15+,16-,17-/m1/s1 |
| InChIKey | PVCHVIWIHLLHQI-YYIAUSFCSA-N |
| XLogP | 2.54 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.38 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|