C32H45NO5 — CID 18634489
[(1S,3R,7S,8S,8aR)-3-[(benzylamino)methyl]-8-[2-[(2R,4R)-4-hydroxy-6-oxooxan-2-yl]ethyl]-7-methyl-1,2,3,7,8,8a-hexahydronaphthalen-1-yl] 2,2-dimethylbutanoate (PubChem CID 18634489) has the molecular formula C32H45NO5 and a molecular weight of 523.71 g/mol. Its IUPAC name is [(1S,3R,7S,8S,8aR)-3-[(benzylamino)methyl]-8-[2-[(2R,4R)-4-hydroxy-6-oxooxan-2-yl]ethyl]-7-methyl-1,2,3,7,8,8a-hexahydronaphthalen-1-yl] 2,2-dimethylbutanoate.
| Compound Name | [(1S,3R,7S,8S,8aR)-3-[(benzylamino)methyl]-8-[2-[(2R,4R)-4-hydroxy-6-oxooxan-2-yl]ethyl]-7-methyl-1,2,3,7,8,8a-hexahydronaphthalen-1-yl] 2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 18634489 |
| Molecular Formula | C32H45NO5 |
| Molecular Weight | 523.71 g/mol |
| Exact Mass | 523.33 |
| IUPAC Name | [(1S,3R,7S,8S,8aR)-3-[(benzylamino)methyl]-8-[2-[(2R,4R)-4-hydroxy-6-oxooxan-2-yl]ethyl]-7-methyl-1,2,3,7,8,8a-hexahydronaphthalen-1-yl] 2,2-dimethylbutanoate |
| SMILES | CCC(C)(C)C(=O)O[C@H]1C[C@@H](CNCc2ccccc2)C=C2C=C[C@H](C)[C@H](CC[C@@H]3C[C@@H](O)CC(=O)O3)[C@H]21 |
| InChI | InChI=1S/C32H45NO5/c1-5-32(3,4)31(36)38-28-16-23(20-33-19-22-9-7-6-8-10-22)15-24-12-11-21(2)27(30(24)28)14-13-26-17-25(34)18-29(35)37-26/h6-12,15,21,23,25-28,30,33-34H,5,13-14,16-20H2,1-4H3/t21-,23-,25+,26+,27-,28-,30-/m0/s1 |
| InChIKey | ARZVTXZLVBAUCA-XIBARGIOSA-N |
| XLogP | 5.36 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.71 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |