C31H42N2O6 — CID 18634494
[(1S,3R,7S,8S,8aR)-3-[(carbamoylamino)-phenylmethyl]-8-[2-[(2R,4R)-4-hydroxy-6-oxooxan-2-yl]ethyl]-7-methyl-1,2,3,7,8,8a-hexahydronaphthalen-1-yl] 2-methylbutanoate (PubChem CID 18634494) has the molecular formula C31H42N2O6 and a molecular weight of 538.69 g/mol. Its IUPAC name is [(1S,3R,7S,8S,8aR)-3-[(carbamoylamino)-phenylmethyl]-8-[2-[(2R,4R)-4-hydroxy-6-oxooxan-2-yl]ethyl]-7-methyl-1,2,3,7,8,8a-hexahydronaphthalen-1-yl] 2-methylbutanoate.
| Compound Name | [(1S,3R,7S,8S,8aR)-3-[(carbamoylamino)-phenylmethyl]-8-[2-[(2R,4R)-4-hydroxy-6-oxooxan-2-yl]ethyl]-7-methyl-1,2,3,7,8,8a-hexahydronaphthalen-1-yl] 2-methylbutanoate |
|---|---|
| PubChem CID | 18634494 |
| Molecular Formula | C31H42N2O6 |
| Molecular Weight | 538.69 g/mol |
| Exact Mass | 538.30 |
| IUPAC Name | [(1S,3R,7S,8S,8aR)-3-[(carbamoylamino)-phenylmethyl]-8-[2-[(2R,4R)-4-hydroxy-6-oxooxan-2-yl]ethyl]-7-methyl-1,2,3,7,8,8a-hexahydronaphthalen-1-yl] 2-methylbutanoate |
| SMILES | CCC(C)C(=O)O[C@H]1C[C@@H](C(NC(N)=O)c2ccccc2)C=C2C=C[C@H](C)[C@H](CC[C@@H]3C[C@@H](O)CC(=O)O3)[C@H]21 |
| InChI | InChI=1S/C31H42N2O6/c1-4-18(2)30(36)39-26-15-22(29(33-31(32)37)20-8-6-5-7-9-20)14-21-11-10-19(3)25(28(21)26)13-12-24-16-23(34)17-27(35)38-24/h5-11,14,18-19,22-26,28-29,34H,4,12-13,15-17H2,1-3H3,(H3,32,33,37)/t18?,19-,22-,23+,24+,25-,26-,28-,29?/m0/s1 |
| InChIKey | AMSOFHQIKLQESF-NXCKJHBISA-N |
| XLogP | 4.59 |
| TPSA | 127.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.69 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |