C31H43NO5 — CID 18634496
[(1S,3S,7S,8S,8aR)-3-[(benzylamino)methyl]-8-[2-[(2R,4R)-4-hydroxy-6-oxooxan-2-yl]ethyl]-7-methyl-1,2,3,7,8,8a-hexahydronaphthalen-1-yl] 2-methylbutanoate (PubChem CID 18634496) has the molecular formula C31H43NO5 and a molecular weight of 509.69 g/mol. Its IUPAC name is [(1S,3S,7S,8S,8aR)-3-[(benzylamino)methyl]-8-[2-[(2R,4R)-4-hydroxy-6-oxooxan-2-yl]ethyl]-7-methyl-1,2,3,7,8,8a-hexahydronaphthalen-1-yl] 2-methylbutanoate.
| Compound Name | [(1S,3S,7S,8S,8aR)-3-[(benzylamino)methyl]-8-[2-[(2R,4R)-4-hydroxy-6-oxooxan-2-yl]ethyl]-7-methyl-1,2,3,7,8,8a-hexahydronaphthalen-1-yl] 2-methylbutanoate |
|---|---|
| PubChem CID | 18634496 |
| Molecular Formula | C31H43NO5 |
| Molecular Weight | 509.69 g/mol |
| Exact Mass | 509.31 |
| IUPAC Name | [(1S,3S,7S,8S,8aR)-3-[(benzylamino)methyl]-8-[2-[(2R,4R)-4-hydroxy-6-oxooxan-2-yl]ethyl]-7-methyl-1,2,3,7,8,8a-hexahydronaphthalen-1-yl] 2-methylbutanoate |
| SMILES | CCC(C)C(=O)O[C@H]1C[C@H](CNCc2ccccc2)C=C2C=C[C@H](C)[C@H](CC[C@@H]3C[C@@H](O)CC(=O)O3)[C@H]21 |
| InChI | InChI=1S/C31H43NO5/c1-4-20(2)31(35)37-28-15-23(19-32-18-22-8-6-5-7-9-22)14-24-11-10-21(3)27(30(24)28)13-12-26-16-25(33)17-29(34)36-26/h5-11,14,20-21,23,25-28,30,32-33H,4,12-13,15-19H2,1-3H3/t20?,21-,23+,25+,26+,27-,28-,30-/m0/s1 |
| InChIKey | DFAQYYPDNBMHOT-RZERVETNSA-N |
| XLogP | 4.97 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.69 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |