C7H18Cl2N2PtSi — CID 18634964
dichloroplatinum;(3S,4R)-1,1-dimethylsilinane-3,4-diamine (PubChem CID 18634964) has the molecular formula C7H18Cl2N2PtSi and a molecular weight of 424.31 g/mol. Its IUPAC name is dichloroplatinum;(3S,4R)-1,1-dimethylsilinane-3,4-diamine.
| Compound Name | dichloroplatinum;(3S,4R)-1,1-dimethylsilinane-3,4-diamine |
|---|---|
| PubChem CID | 18634964 |
| Molecular Formula | C7H18Cl2N2PtSi |
| Molecular Weight | 424.31 g/mol |
| Exact Mass | 423.03 |
| IUPAC Name | dichloroplatinum;(3S,4R)-1,1-dimethylsilinane-3,4-diamine |
| SMILES | C[Si]1(C)CC[C@@H](N)[C@H](N)C1.Cl[Pt]Cl |
| InChI | InChI=1S/C7H18N2Si.2ClH.Pt/c1-10(2)4-3-6(8)7(9)5-10;;;/h6-7H,3-5,8-9H2,1-2H3;2*1H;/q;;;+2/p-2/t6-,7-;;;/m1.../s1 |
| InChIKey | ADRBSYSTKQGFAZ-YFJLMHTMSA-L |
| XLogP | 2.13 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.31 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|