C7H18N2Si — CID 18634965
(3S,4R)-1,1-dimethylsilinane-3,4-diamine (PubChem CID 18634965) has the molecular formula C7H18N2Si and a molecular weight of 158.32 g/mol. Its IUPAC name is (3S,4R)-1,1-dimethylsilinane-3,4-diamine.
| Compound Name | (3S,4R)-1,1-dimethylsilinane-3,4-diamine |
|---|---|
| PubChem CID | 18634965 |
| Molecular Formula | C7H18N2Si |
| Molecular Weight | 158.32 g/mol |
| Exact Mass | 158.12 |
| IUPAC Name | (3S,4R)-1,1-dimethylsilinane-3,4-diamine |
| SMILES | C[Si]1(C)CC[C@@H](N)[C@H](N)C1 |
| InChI | InChI=1S/C7H18N2Si/c1-10(2)4-3-6(8)7(9)5-10/h6-7H,3-5,8-9H2,1-2H3/t6-,7-/m1/s1 |
| InChIKey | ZKFFIPOVKHQHNV-RNFRBKRXSA-N |
| XLogP | 0.75 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.32 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|