C21H31ClHgO2 — CID 18635282
[(8S,9S,10R,13S,14S,17S)-17-acetyl-3-hydroxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-6-yl]-chloromercury (PubChem CID 18635282) has the molecular formula C21H31ClHgO2 and a molecular weight of 551.52 g/mol. Its IUPAC name is [(8S,9S,10R,13S,14S,17S)-17-acetyl-3-hydroxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-6-yl]-chloromercury.
| Compound Name | [(8S,9S,10R,13S,14S,17S)-17-acetyl-3-hydroxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-6-yl]-chloromercury |
|---|---|
| PubChem CID | 18635282 |
| Molecular Formula | C21H31ClHgO2 |
| Molecular Weight | 551.52 g/mol |
| Exact Mass | 552.17 |
| IUPAC Name | [(8S,9S,10R,13S,14S,17S)-17-acetyl-3-hydroxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-6-yl]-chloromercury |
| SMILES | CC(=O)[C@H]1CC[C@H]2[C@@H]3CC([Hg]Cl)=C4CC(O)CC[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C21H31O2.ClH.Hg/c1-13(22)17-6-7-18-16-5-4-14-12-15(23)8-10-20(14,2)19(16)9-11-21(17,18)3;;/h15-19,23H,5-12H2,1-3H3;1H;/q;;+1/p-1/t15?,16-,17+,18-,19-,20-,21+;;/m0../s1 |
| InChIKey | QMBZQUBWLBLOHX-ARKGTJLISA-M |
| XLogP | 5.08 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.52 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|