C22H32O3 — CID 18635399
(3aR)-11b-methoxy-3a,6-dimethylspiro[1,2,3,4,7,9,10,10a,11,11a-decahydrocyclopenta[a]anthracene-8,2'-1,3-dioxolane] (PubChem CID 18635399) has the molecular formula C22H32O3 and a molecular weight of 344.50 g/mol. Its IUPAC name is (3aR)-11b-methoxy-3a,6-dimethylspiro[1,2,3,4,7,9,10,10a,11,11a-decahydrocyclopenta[a]anthracene-8,2'-1,3-dioxolane].
| Compound Name | (3aR)-11b-methoxy-3a,6-dimethylspiro[1,2,3,4,7,9,10,10a,11,11a-decahydrocyclopenta[a]anthracene-8,2'-1,3-dioxolane] |
|---|---|
| PubChem CID | 18635399 |
| Molecular Formula | C22H32O3 |
| Molecular Weight | 344.50 g/mol |
| Exact Mass | 344.24 |
| IUPAC Name | (3aR)-11b-methoxy-3a,6-dimethylspiro[1,2,3,4,7,9,10,10a,11,11a-decahydrocyclopenta[a]anthracene-8,2'-1,3-dioxolane] |
| SMILES | COC12CCC[C@]1(C)CC=C1C(C)=C3CC4(CCC3CC12)OCCO4 |
| InChI | InChI=1S/C22H32O3/c1-15-17-6-9-20(2)7-4-8-22(20,23-3)19(17)13-16-5-10-21(14-18(15)16)24-11-12-25-21/h6,16,19H,4-5,7-14H2,1-3H3/t16?,19?,20-,22?/m1/s1 |
| InChIKey | KDIAIDHGIOIQKO-YDTYHVGYSA-N |
| XLogP | 4.77 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.50 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |