About (2R)-1-[(2S)-2,6-diaminohexanoyl]-2-(5-heptyl-2-oxooxolan-3-yl)pyrrolidine-2-carboxylic acid
(2R)-1-[(2S)-2,6-diaminohexanoyl]-2-(5-heptyl-2-oxooxolan-3-yl)pyrrolidine-2-carboxylic acid (PubChem CID 18635451) has the molecular formula C22H39N3O5
and a molecular weight of 425.57 g/mol. Its IUPAC name is (2R)-1-[(2S)-2,6-diaminohexanoyl]-2-(5-heptyl-2-oxooxolan-3-yl)pyrrolidine-2-carboxylic acid.
Molecular Properties
| Compound Name | (2R)-1-[(2S)-2,6-diaminohexanoyl]-2-(5-heptyl-2-oxooxolan-3-yl)pyrrolidine-2-carboxylic acid |
| PubChem CID | 18635451 |
| Molecular Formula | C22H39N3O5 |
| Molecular Weight | 425.57 g/mol |
| Exact Mass | 425.29 |
| IUPAC Name | (2R)-1-[(2S)-2,6-diaminohexanoyl]-2-(5-heptyl-2-oxooxolan-3-yl)pyrrolidine-2-carboxylic acid |
| SMILES | CCCCCCCC1CC([C@@]2(C(=O)O)CCCN2C(=O)[C@@H](N)CCCCN)C(=O)O1 |
| InChI | InChI=1S/C22H39N3O5/c1-2-3-4-5-6-10-16-15-17(20(27)30-16)22(21(28)29)12-9-14-25(22)19(26)18(24)11-7-8-13-23/h16-18H,2-15,23-24H2,1H3,(H,28,29)/t16?,17?,18-,22+/m0/s1 |
| InChIKey | APONGSORZOSZNE-PNXXNBOHSA-N |
| XLogP | 2.18 |
| TPSA | 135.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 425.57 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze (2R)-1-[(2S)-2,6-diaminohexanoyl]-2-(5-heptyl-2-oxooxolan-3-yl)pyrrolidine-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-1-[(2S)-2,6-diaminohexanoyl]-2-(5-heptyl-2-oxooxolan-3-yl)pyrrolidine-2-carboxylic acid?
The IUPAC name of (2R)-1-[(2S)-2,6-diaminohexanoyl]-2-(5-heptyl-2-oxooxolan-3-yl)pyrrolidine-2-carboxylic acid (CID 18635451) is (2R)-1-[(2S)-2,6-diaminohexanoyl]-2-(5-heptyl-2-oxooxolan-3-yl)pyrrolidine-2-carboxylic acid.
What is the SMILES notation for (2R)-1-[(2S)-2,6-diaminohexanoyl]-2-(5-heptyl-2-oxooxolan-3-yl)pyrrolidine-2-carboxylic acid?
The canonical SMILES for (2R)-1-[(2S)-2,6-diaminohexanoyl]-2-(5-heptyl-2-oxooxolan-3-yl)pyrrolidine-2-carboxylic acid is CCCCCCCC1CC([C@@]2(C(=O)O)CCCN2C(=O)[C@@H](N)CCCCN)C(=O)O1.
What is the InChIKey of (2R)-1-[(2S)-2,6-diaminohexanoyl]-2-(5-heptyl-2-oxooxolan-3-yl)pyrrolidine-2-carboxylic acid?
The InChIKey is APONGSORZOSZNE-PNXXNBOHSA-N. The full InChI is InChI=1S/C22H39N3O5/c1-2-3-4-5-6-10-16-15-17(20(27)30-16)22(21(28)29)12-9-14-25(22)19(26)18(24)11-7-8-13-23/h16-18H,2-15,23-24H2,1H3,(H,28,29)/t16?,17?,18-,22+/m0/s1.
What are the key properties of (2R)-1-[(2S)-2,6-diaminohexanoyl]-2-(5-heptyl-2-oxooxolan-3-yl)pyrrolidine-2-carboxylic acid?
(2R)-1-[(2S)-2,6-diaminohexanoyl]-2-(5-heptyl-2-oxooxolan-3-yl)pyrrolidine-2-carboxylic acid has a molecular weight of 425.57 g/mol, XLogP of 2.18, 13 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-1-[(2S)-2,6-diaminohexanoyl]-2-(5-heptyl-2-oxooxolan-3-yl)pyrrolidine-2-carboxylic acid is sourced from PubChem (CID 18635451), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).