C29H37FO6 — CID 18635466
[(1S,3R,7S,8S,8aR)-8-[2-[(2R,4R)-4-hydroxy-6-oxooxan-2-yl]ethyl]-3,7-dimethyl-1,2,3,7,8,8a-hexahydronaphthalen-1-yl] 2-(3-fluoro-4-hydroxyphenyl)-2-methylpropanoate (PubChem CID 18635466) has the molecular formula C29H37FO6 and a molecular weight of 500.61 g/mol. Its IUPAC name is [(1S,3R,7S,8S,8aR)-8-[2-[(2R,4R)-4-hydroxy-6-oxooxan-2-yl]ethyl]-3,7-dimethyl-1,2,3,7,8,8a-hexahydronaphthalen-1-yl] 2-(3-fluoro-4-hydroxyphenyl)-2-methylpropanoate.
| Compound Name | [(1S,3R,7S,8S,8aR)-8-[2-[(2R,4R)-4-hydroxy-6-oxooxan-2-yl]ethyl]-3,7-dimethyl-1,2,3,7,8,8a-hexahydronaphthalen-1-yl] 2-(3-fluoro-4-hydroxyphenyl)-2-methylpropanoate |
|---|---|
| PubChem CID | 18635466 |
| Molecular Formula | C29H37FO6 |
| Molecular Weight | 500.61 g/mol |
| Exact Mass | 500.26 |
| IUPAC Name | [(1S,3R,7S,8S,8aR)-8-[2-[(2R,4R)-4-hydroxy-6-oxooxan-2-yl]ethyl]-3,7-dimethyl-1,2,3,7,8,8a-hexahydronaphthalen-1-yl] 2-(3-fluoro-4-hydroxyphenyl)-2-methylpropanoate |
| SMILES | C[C@H]1C=C2C=C[C@H](C)[C@H](CC[C@@H]3C[C@@H](O)CC(=O)O3)[C@H]2[C@@H](OC(=O)C(C)(C)c2ccc(O)c(F)c2)C1 |
| InChI | InChI=1S/C29H37FO6/c1-16-11-18-6-5-17(2)22(9-8-21-14-20(31)15-26(33)35-21)27(18)25(12-16)36-28(34)29(3,4)19-7-10-24(32)23(30)13-19/h5-7,10-11,13,16-17,20-22,25,27,31-32H,8-9,12,14-15H2,1-4H3/t16-,17-,20+,21+,22-,25-,27-/m0/s1 |
| InChIKey | GOALRQPAQGTJCO-DJFJUWPKSA-N |
| XLogP | 4.97 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.61 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |