C22H24FNO3 — CID 18635546
(3R,4S)-3-(1,3-benzodioxol-5-yloxymethyl)-4-(4-fluorophenyl)-1-prop-2-enylpiperidine (PubChem CID 18635546) has the molecular formula C22H24FNO3 and a molecular weight of 369.44 g/mol. Its IUPAC name is (3R,4S)-3-(1,3-benzodioxol-5-yloxymethyl)-4-(4-fluorophenyl)-1-prop-2-enylpiperidine.
| Compound Name | (3R,4S)-3-(1,3-benzodioxol-5-yloxymethyl)-4-(4-fluorophenyl)-1-prop-2-enylpiperidine |
|---|---|
| PubChem CID | 18635546 |
| Molecular Formula | C22H24FNO3 |
| Molecular Weight | 369.44 g/mol |
| Exact Mass | 369.17 |
| IUPAC Name | (3R,4S)-3-(1,3-benzodioxol-5-yloxymethyl)-4-(4-fluorophenyl)-1-prop-2-enylpiperidine |
| SMILES | C=CCN1CC[C@H](c2ccc(F)cc2)[C@@H](COc2ccc3c(c2)OCO3)C1 |
| InChI | InChI=1S/C22H24FNO3/c1-2-10-24-11-9-20(16-3-5-18(23)6-4-16)17(13-24)14-25-19-7-8-21-22(12-19)27-15-26-21/h2-8,12,17,20H,1,9-11,13-15H2/t17-,20-/m1/s1 |
| InChIKey | WSQXSBSDENLAHD-YLJYHZDGSA-N |
| XLogP | 4.22 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.44 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|