C14H20N2O — CID 18635613
3-[(1R,4aR,8aS)-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-1-yl]imidazole-4-carbaldehyde (PubChem CID 18635613) has the molecular formula C14H20N2O and a molecular weight of 232.33 g/mol. Its IUPAC name is 3-[(1R,4aR,8aS)-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-1-yl]imidazole-4-carbaldehyde.
| Compound Name | 3-[(1R,4aR,8aS)-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-1-yl]imidazole-4-carbaldehyde |
|---|---|
| PubChem CID | 18635613 |
| Molecular Formula | C14H20N2O |
| Molecular Weight | 232.33 g/mol |
| Exact Mass | 232.16 |
| IUPAC Name | 3-[(1R,4aR,8aS)-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-1-yl]imidazole-4-carbaldehyde |
| SMILES | O=Cc1cncn1[C@@H]1CCC[C@H]2CCCC[C@@H]21 |
| InChI | InChI=1S/C14H20N2O/c17-9-12-8-15-10-16(12)14-7-3-5-11-4-1-2-6-13(11)14/h8-11,13-14H,1-7H2/t11-,13+,14-/m1/s1 |
| InChIKey | DROMJPNCZLSNQG-KWCYVHTRSA-N |
| XLogP | 3.23 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.33 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|