C14H22N2O — CID 18635615
[3-[(1R,4aR,8aS)-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-1-yl]imidazol-4-yl]methanol (PubChem CID 18635615) has the molecular formula C14H22N2O and a molecular weight of 234.34 g/mol. Its IUPAC name is [3-[(1R,4aR,8aS)-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-1-yl]imidazol-4-yl]methanol.
| Compound Name | [3-[(1R,4aR,8aS)-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-1-yl]imidazol-4-yl]methanol |
|---|---|
| PubChem CID | 18635615 |
| Molecular Formula | C14H22N2O |
| Molecular Weight | 234.34 g/mol |
| Exact Mass | 234.17 |
| IUPAC Name | [3-[(1R,4aR,8aS)-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-1-yl]imidazol-4-yl]methanol |
| SMILES | OCc1cncn1[C@@H]1CCC[C@H]2CCCC[C@@H]21 |
| InChI | InChI=1S/C14H22N2O/c17-9-12-8-15-10-16(12)14-7-3-5-11-4-1-2-6-13(11)14/h8,10-11,13-14,17H,1-7,9H2/t11-,13+,14-/m1/s1 |
| InChIKey | VZCSKDZBGFZILM-KWCYVHTRSA-N |
| XLogP | 2.91 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.34 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |