C15H24N2O — CID 18635616
1-[3-[(1R,4aR,8aS)-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-1-yl]imidazol-4-yl]ethanol (PubChem CID 18635616) has the molecular formula C15H24N2O and a molecular weight of 248.37 g/mol. Its IUPAC name is 1-[3-[(1R,4aR,8aS)-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-1-yl]imidazol-4-yl]ethanol.
| Compound Name | 1-[3-[(1R,4aR,8aS)-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-1-yl]imidazol-4-yl]ethanol |
|---|---|
| PubChem CID | 18635616 |
| Molecular Formula | C15H24N2O |
| Molecular Weight | 248.37 g/mol |
| Exact Mass | 248.19 |
| IUPAC Name | 1-[3-[(1R,4aR,8aS)-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-1-yl]imidazol-4-yl]ethanol |
| SMILES | CC(O)c1cncn1[C@@H]1CCC[C@H]2CCCC[C@@H]21 |
| InChI | InChI=1S/C15H24N2O/c1-11(18)15-9-16-10-17(15)14-8-4-6-12-5-2-3-7-13(12)14/h9-14,18H,2-8H2,1H3/t11?,12-,13+,14-/m1/s1 |
| InChIKey | JPAIVNQWRCZGEU-WTUNAVPPSA-N |
| XLogP | 3.47 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.37 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |