C21H33N3O3 — CID 18636003
methyl (8R,9S,10S,13R,17S)-14-azido-3-hydroxy-10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,15,16,17-tetradecahydrocyclopenta[a]phenanthrene-17-carboxylate (PubChem CID 18636003) has the molecular formula C21H33N3O3 and a molecular weight of 375.51 g/mol. Its IUPAC name is methyl (8R,9S,10S,13R,17S)-14-azido-3-hydroxy-10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,15,16,17-tetradecahydrocyclopenta[a]phenanthrene-17-carboxylate.
| Compound Name | methyl (8R,9S,10S,13R,17S)-14-azido-3-hydroxy-10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,15,16,17-tetradecahydrocyclopenta[a]phenanthrene-17-carboxylate |
|---|---|
| PubChem CID | 18636003 |
| Molecular Formula | C21H33N3O3 |
| Molecular Weight | 375.51 g/mol |
| Exact Mass | 375.25 |
| IUPAC Name | methyl (8R,9S,10S,13R,17S)-14-azido-3-hydroxy-10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,15,16,17-tetradecahydrocyclopenta[a]phenanthrene-17-carboxylate |
| SMILES | COC(=O)[C@H]1CCC2(N=[N+]=[N-])[C@@H]3CCC4CC(O)CC[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C21H33N3O3/c1-19-9-6-14(25)12-13(19)4-5-16-15(19)7-10-20(2)17(18(26)27-3)8-11-21(16,20)23-24-22/h13-17,25H,4-12H2,1-3H3/t13?,14?,15-,16+,17+,19-,20+,21?/m0/s1 |
| InChIKey | CTYVHYMHLIEJDK-NNQUUMCESA-N |
| XLogP | 4.61 |
| TPSA | 95.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.51 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|