C20H31ClN2O3S — CID 18636475
(8aR,12aS,13aS)-3-ethoxy-12-ethylsulfonyl-5,6,8,8a,9,10,11,12a,13,13a-decahydroisoquinolino[2,1-g][1,6]naphthyridine;hydrochloride (PubChem CID 18636475) has the molecular formula C20H31ClN2O3S and a molecular weight of 415.00 g/mol. Its IUPAC name is (8aR,12aS,13aS)-3-ethoxy-12-ethylsulfonyl-5,6,8,8a,9,10,11,12a,13,13a-decahydroisoquinolino[2,1-g][1,6]naphthyridine;hydrochloride.
| Compound Name | (8aR,12aS,13aS)-3-ethoxy-12-ethylsulfonyl-5,6,8,8a,9,10,11,12a,13,13a-decahydroisoquinolino[2,1-g][1,6]naphthyridine;hydrochloride |
|---|---|
| PubChem CID | 18636475 |
| Molecular Formula | C20H31ClN2O3S |
| Molecular Weight | 415.00 g/mol |
| Exact Mass | 414.17 |
| IUPAC Name | (8aR,12aS,13aS)-3-ethoxy-12-ethylsulfonyl-5,6,8,8a,9,10,11,12a,13,13a-decahydroisoquinolino[2,1-g][1,6]naphthyridine;hydrochloride |
| SMILES | CCOc1ccc2c(c1)CCN1C[C@H]3CCCN(S(=O)(=O)CC)[C@H]3C[C@@H]21.Cl |
| InChI | InChI=1S/C20H30N2O3S.ClH/c1-3-25-17-7-8-18-15(12-17)9-11-21-14-16-6-5-10-22(26(23,24)4-2)19(16)13-20(18)21;/h7-8,12,16,19-20H,3-6,9-11,13-14H2,1-2H3;1H/t16-,19+,20+;/m1./s1 |
| InChIKey | BLSIYASKBOTTJG-WHRPDVDQSA-N |
| XLogP | 3.24 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.00 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |