About 7-[(1R)-2-(3-hydroxyoctyl)-5-oxocyclopent-2-en-1-yl]hepta-3,4-dienoic acid
7-[(1R)-2-(3-hydroxyoctyl)-5-oxocyclopent-2-en-1-yl]hepta-3,4-dienoic acid (PubChem CID 18636536) has the molecular formula C20H30O4
and a molecular weight of 334.46 g/mol. Its IUPAC name is 7-[(1R)-2-(3-hydroxyoctyl)-5-oxocyclopent-2-en-1-yl]hepta-3,4-dienoic acid.
Molecular Properties
| Compound Name | 7-[(1R)-2-(3-hydroxyoctyl)-5-oxocyclopent-2-en-1-yl]hepta-3,4-dienoic acid |
| PubChem CID | 18636536 |
| Molecular Formula | C20H30O4 |
| Molecular Weight | 334.46 g/mol |
| Exact Mass | 334.21 |
| IUPAC Name | 7-[(1R)-2-(3-hydroxyoctyl)-5-oxocyclopent-2-en-1-yl]hepta-3,4-dienoic acid |
| SMILES | CCCCCC(O)CCC1=CCC(=O)[C@@H]1CCC=C=CCC(=O)O |
| InChI | InChI=1S/C20H30O4/c1-2-3-6-9-17(21)14-12-16-13-15-19(22)18(16)10-7-4-5-8-11-20(23)24/h4,8,13,17-18,21H,2-3,6-7,9-12,14-15H2,1H3,(H,23,24)/t5?,17?,18-/m1/s1 |
| InChIKey | KNHFTMKQZPLRHQ-ITVJEQDXSA-N |
| XLogP | 4.19 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.46 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 7-[(1R)-2-(3-hydroxyoctyl)-5-oxocyclopent-2-en-1-yl]hepta-3,4-dienoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-[(1R)-2-(3-hydroxyoctyl)-5-oxocyclopent-2-en-1-yl]hepta-3,4-dienoic acid?
The IUPAC name of 7-[(1R)-2-(3-hydroxyoctyl)-5-oxocyclopent-2-en-1-yl]hepta-3,4-dienoic acid (CID 18636536) is 7-[(1R)-2-(3-hydroxyoctyl)-5-oxocyclopent-2-en-1-yl]hepta-3,4-dienoic acid.
What is the SMILES notation for 7-[(1R)-2-(3-hydroxyoctyl)-5-oxocyclopent-2-en-1-yl]hepta-3,4-dienoic acid?
The canonical SMILES for 7-[(1R)-2-(3-hydroxyoctyl)-5-oxocyclopent-2-en-1-yl]hepta-3,4-dienoic acid is CCCCCC(O)CCC1=CCC(=O)[C@@H]1CCC=C=CCC(=O)O.
What is the InChIKey of 7-[(1R)-2-(3-hydroxyoctyl)-5-oxocyclopent-2-en-1-yl]hepta-3,4-dienoic acid?
The InChIKey is KNHFTMKQZPLRHQ-ITVJEQDXSA-N. The full InChI is InChI=1S/C20H30O4/c1-2-3-6-9-17(21)14-12-16-13-15-19(22)18(16)10-7-4-5-8-11-20(23)24/h4,8,13,17-18,21H,2-3,6-7,9-12,14-15H2,1H3,(H,23,24)/t5?,17?,18-/m1/s1.
What are the key properties of 7-[(1R)-2-(3-hydroxyoctyl)-5-oxocyclopent-2-en-1-yl]hepta-3,4-dienoic acid?
7-[(1R)-2-(3-hydroxyoctyl)-5-oxocyclopent-2-en-1-yl]hepta-3,4-dienoic acid has a molecular weight of 334.46 g/mol, XLogP of 4.19, 12 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-[(1R)-2-(3-hydroxyoctyl)-5-oxocyclopent-2-en-1-yl]hepta-3,4-dienoic acid is sourced from PubChem (CID 18636536), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).