C22H30O6S — CID 18636539
2-[(1R,5S)-2-[2-(benzenesulfonyl)-3-oxooctyl]-5-hydroxy-1-methylcyclopent-2-en-1-yl]acetic acid (PubChem CID 18636539) has the molecular formula C22H30O6S and a molecular weight of 422.54 g/mol. Its IUPAC name is 2-[(1R,5S)-2-[2-(benzenesulfonyl)-3-oxooctyl]-5-hydroxy-1-methylcyclopent-2-en-1-yl]acetic acid.
| Compound Name | 2-[(1R,5S)-2-[2-(benzenesulfonyl)-3-oxooctyl]-5-hydroxy-1-methylcyclopent-2-en-1-yl]acetic acid |
|---|---|
| PubChem CID | 18636539 |
| Molecular Formula | C22H30O6S |
| Molecular Weight | 422.54 g/mol |
| Exact Mass | 422.18 |
| IUPAC Name | 2-[(1R,5S)-2-[2-(benzenesulfonyl)-3-oxooctyl]-5-hydroxy-1-methylcyclopent-2-en-1-yl]acetic acid |
| SMILES | CCCCCC(=O)C(CC1=CC[C@H](O)[C@]1(C)CC(=O)O)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C22H30O6S/c1-3-4-6-11-18(23)19(29(27,28)17-9-7-5-8-10-17)14-16-12-13-20(24)22(16,2)15-21(25)26/h5,7-10,12,19-20,24H,3-4,6,11,13-15H2,1-2H3,(H,25,26)/t19?,20-,22+/m0/s1 |
| InChIKey | HYIQROJDMQFKIW-VDZZXDNDSA-N |
| XLogP | 3.54 |
| TPSA | 108.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.54 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|