About 2-[(1R,5S)-5-hydroxy-1-methyl-2-(3-oxooctyl)cyclopent-2-en-1-yl]acetic acid
2-[(1R,5S)-5-hydroxy-1-methyl-2-(3-oxooctyl)cyclopent-2-en-1-yl]acetic acid (PubChem CID 18636542) has the molecular formula C16H26O4
and a molecular weight of 282.38 g/mol. Its IUPAC name is 2-[(1R,5S)-5-hydroxy-1-methyl-2-(3-oxooctyl)cyclopent-2-en-1-yl]acetic acid.
Molecular Properties
| Compound Name | 2-[(1R,5S)-5-hydroxy-1-methyl-2-(3-oxooctyl)cyclopent-2-en-1-yl]acetic acid |
| PubChem CID | 18636542 |
| Molecular Formula | C16H26O4 |
| Molecular Weight | 282.38 g/mol |
| Exact Mass | 282.18 |
| IUPAC Name | 2-[(1R,5S)-5-hydroxy-1-methyl-2-(3-oxooctyl)cyclopent-2-en-1-yl]acetic acid |
| SMILES | CCCCCC(=O)CCC1=CC[C@H](O)[C@]1(C)CC(=O)O |
| InChI | InChI=1S/C16H26O4/c1-3-4-5-6-13(17)9-7-12-8-10-14(18)16(12,2)11-15(19)20/h8,14,18H,3-7,9-11H2,1-2H3,(H,19,20)/t14-,16+/m0/s1 |
| InChIKey | AHPQCLAKHKOAHP-GOEBONIOSA-N |
| XLogP | 3.09 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.38 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-[(1R,5S)-5-hydroxy-1-methyl-2-(3-oxooctyl)cyclopent-2-en-1-yl]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(1R,5S)-5-hydroxy-1-methyl-2-(3-oxooctyl)cyclopent-2-en-1-yl]acetic acid?
The IUPAC name of 2-[(1R,5S)-5-hydroxy-1-methyl-2-(3-oxooctyl)cyclopent-2-en-1-yl]acetic acid (CID 18636542) is 2-[(1R,5S)-5-hydroxy-1-methyl-2-(3-oxooctyl)cyclopent-2-en-1-yl]acetic acid.
What is the SMILES notation for 2-[(1R,5S)-5-hydroxy-1-methyl-2-(3-oxooctyl)cyclopent-2-en-1-yl]acetic acid?
The canonical SMILES for 2-[(1R,5S)-5-hydroxy-1-methyl-2-(3-oxooctyl)cyclopent-2-en-1-yl]acetic acid is CCCCCC(=O)CCC1=CC[C@H](O)[C@]1(C)CC(=O)O.
What is the InChIKey of 2-[(1R,5S)-5-hydroxy-1-methyl-2-(3-oxooctyl)cyclopent-2-en-1-yl]acetic acid?
The InChIKey is AHPQCLAKHKOAHP-GOEBONIOSA-N. The full InChI is InChI=1S/C16H26O4/c1-3-4-5-6-13(17)9-7-12-8-10-14(18)16(12,2)11-15(19)20/h8,14,18H,3-7,9-11H2,1-2H3,(H,19,20)/t14-,16+/m0/s1.
What are the key properties of 2-[(1R,5S)-5-hydroxy-1-methyl-2-(3-oxooctyl)cyclopent-2-en-1-yl]acetic acid?
2-[(1R,5S)-5-hydroxy-1-methyl-2-(3-oxooctyl)cyclopent-2-en-1-yl]acetic acid has a molecular weight of 282.38 g/mol, XLogP of 3.09, 9 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(1R,5S)-5-hydroxy-1-methyl-2-(3-oxooctyl)cyclopent-2-en-1-yl]acetic acid is sourced from PubChem (CID 18636542), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).