C22H42O5Si — CID 18636557
2-[(1R,2R,3R,5S)-2-[3-[tert-butyl(dimethyl)silyl]oxy-3-cyclohexylpropyl]-3,5-dihydroxycyclopentyl]acetic acid (PubChem CID 18636557) has the molecular formula C22H42O5Si and a molecular weight of 414.66 g/mol. Its IUPAC name is 2-[(1R,2R,3R,5S)-2-[3-[tert-butyl(dimethyl)silyl]oxy-3-cyclohexylpropyl]-3,5-dihydroxycyclopentyl]acetic acid.
| Compound Name | 2-[(1R,2R,3R,5S)-2-[3-[tert-butyl(dimethyl)silyl]oxy-3-cyclohexylpropyl]-3,5-dihydroxycyclopentyl]acetic acid |
|---|---|
| PubChem CID | 18636557 |
| Molecular Formula | C22H42O5Si |
| Molecular Weight | 414.66 g/mol |
| Exact Mass | 414.28 |
| IUPAC Name | 2-[(1R,2R,3R,5S)-2-[3-[tert-butyl(dimethyl)silyl]oxy-3-cyclohexylpropyl]-3,5-dihydroxycyclopentyl]acetic acid |
| SMILES | CC(C)(C)[Si](C)(C)OC(CC[C@@H]1[C@@H](CC(=O)O)[C@@H](O)C[C@H]1O)C1CCCCC1 |
| InChI | InChI=1S/C22H42O5Si/c1-22(2,3)28(4,5)27-20(15-9-7-6-8-10-15)12-11-16-17(13-21(25)26)19(24)14-18(16)23/h15-20,23-24H,6-14H2,1-5H3,(H,25,26)/t16-,17-,18-,19+,20?/m1/s1 |
| InChIKey | KSBSZAKCXXIYMQ-BNCGXOKJSA-N |
| XLogP | 4.57 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.66 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|