C23H44O5Si — CID 18636558
2-[(1R,2R,3R,5S)-2-[3-[tert-butyl(dimethyl)silyl]oxy-3-cyclohexylbutyl]-3,5-dihydroxycyclopentyl]acetic acid (PubChem CID 18636558) has the molecular formula C23H44O5Si and a molecular weight of 428.69 g/mol. Its IUPAC name is 2-[(1R,2R,3R,5S)-2-[3-[tert-butyl(dimethyl)silyl]oxy-3-cyclohexylbutyl]-3,5-dihydroxycyclopentyl]acetic acid.
| Compound Name | 2-[(1R,2R,3R,5S)-2-[3-[tert-butyl(dimethyl)silyl]oxy-3-cyclohexylbutyl]-3,5-dihydroxycyclopentyl]acetic acid |
|---|---|
| PubChem CID | 18636558 |
| Molecular Formula | C23H44O5Si |
| Molecular Weight | 428.69 g/mol |
| Exact Mass | 428.30 |
| IUPAC Name | 2-[(1R,2R,3R,5S)-2-[3-[tert-butyl(dimethyl)silyl]oxy-3-cyclohexylbutyl]-3,5-dihydroxycyclopentyl]acetic acid |
| SMILES | CC(CC[C@@H]1[C@@H](CC(=O)O)[C@@H](O)C[C@H]1O)(O[Si](C)(C)C(C)(C)C)C1CCCCC1 |
| InChI | InChI=1S/C23H44O5Si/c1-22(2,3)29(5,6)28-23(4,16-10-8-7-9-11-16)13-12-17-18(14-21(26)27)20(25)15-19(17)24/h16-20,24-25H,7-15H2,1-6H3,(H,26,27)/t17-,18-,19-,20+,23?/m1/s1 |
| InChIKey | XJWYFEARBPFHGK-FGSBKZAUSA-N |
| XLogP | 4.96 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.69 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|