C24H46O2Si — CID 18636601
(1S,2R)-3-[3-[tert-butyl(dimethyl)silyl]oxy-4-methylnonyl]-2-prop-2-enylcyclopent-3-en-1-ol (PubChem CID 18636601) has the molecular formula C24H46O2Si and a molecular weight of 394.72 g/mol. Its IUPAC name is (1S,2R)-3-[3-[tert-butyl(dimethyl)silyl]oxy-4-methylnonyl]-2-prop-2-enylcyclopent-3-en-1-ol.
| Compound Name | (1S,2R)-3-[3-[tert-butyl(dimethyl)silyl]oxy-4-methylnonyl]-2-prop-2-enylcyclopent-3-en-1-ol |
|---|---|
| PubChem CID | 18636601 |
| Molecular Formula | C24H46O2Si |
| Molecular Weight | 394.72 g/mol |
| Exact Mass | 394.33 |
| IUPAC Name | (1S,2R)-3-[3-[tert-butyl(dimethyl)silyl]oxy-4-methylnonyl]-2-prop-2-enylcyclopent-3-en-1-ol |
| SMILES | C=CC[C@@H]1C(CCC(O[Si](C)(C)C(C)(C)C)C(C)CCCCC)=CC[C@@H]1O |
| InChI | InChI=1S/C24H46O2Si/c1-9-11-12-14-19(3)23(26-27(7,8)24(4,5)6)18-16-20-15-17-22(25)21(20)13-10-2/h10,15,19,21-23,25H,2,9,11-14,16-18H2,1,3-8H3/t19?,21-,22+,23?/m1/s1 |
| InChIKey | CXQDWRFFJRODOY-JZEAKTPCSA-N |
| XLogP | 7.26 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.72 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|