C23H44O2Si — CID 18636605
(1S,2R)-3-[3-[tert-butyl(dimethyl)silyl]oxy-4-methyloctyl]-2-prop-2-enylcyclopent-3-en-1-ol (PubChem CID 18636605) has the molecular formula C23H44O2Si and a molecular weight of 380.69 g/mol. Its IUPAC name is (1S,2R)-3-[3-[tert-butyl(dimethyl)silyl]oxy-4-methyloctyl]-2-prop-2-enylcyclopent-3-en-1-ol.
| Compound Name | (1S,2R)-3-[3-[tert-butyl(dimethyl)silyl]oxy-4-methyloctyl]-2-prop-2-enylcyclopent-3-en-1-ol |
|---|---|
| PubChem CID | 18636605 |
| Molecular Formula | C23H44O2Si |
| Molecular Weight | 380.69 g/mol |
| Exact Mass | 380.31 |
| IUPAC Name | (1S,2R)-3-[3-[tert-butyl(dimethyl)silyl]oxy-4-methyloctyl]-2-prop-2-enylcyclopent-3-en-1-ol |
| SMILES | C=CC[C@@H]1C(CCC(O[Si](C)(C)C(C)(C)C)C(C)CCCC)=CC[C@@H]1O |
| InChI | InChI=1S/C23H44O2Si/c1-9-11-13-18(3)22(25-26(7,8)23(4,5)6)17-15-19-14-16-21(24)20(19)12-10-2/h10,14,18,20-22,24H,2,9,11-13,15-17H2,1,3-8H3/t18?,20-,21+,22?/m1/s1 |
| InChIKey | ZQEFPFOMQBEFFU-SGCCOESXSA-N |
| XLogP | 6.87 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.69 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|