C29H58O3Si2 — CID 18636627
3-[(1R,5S)-2-[(3S)-3-[tert-butyl(dimethyl)silyl]oxy-3-cyclohexylpropyl]-5-triethylsilyloxycyclopent-2-en-1-yl]propan-1-ol (PubChem CID 18636627) has the molecular formula C29H58O3Si2 and a molecular weight of 510.95 g/mol. Its IUPAC name is 3-[(1R,5S)-2-[(3S)-3-[tert-butyl(dimethyl)silyl]oxy-3-cyclohexylpropyl]-5-triethylsilyloxycyclopent-2-en-1-yl]propan-1-ol.
| Compound Name | 3-[(1R,5S)-2-[(3S)-3-[tert-butyl(dimethyl)silyl]oxy-3-cyclohexylpropyl]-5-triethylsilyloxycyclopent-2-en-1-yl]propan-1-ol |
|---|---|
| PubChem CID | 18636627 |
| Molecular Formula | C29H58O3Si2 |
| Molecular Weight | 510.95 g/mol |
| Exact Mass | 510.39 |
| IUPAC Name | 3-[(1R,5S)-2-[(3S)-3-[tert-butyl(dimethyl)silyl]oxy-3-cyclohexylpropyl]-5-triethylsilyloxycyclopent-2-en-1-yl]propan-1-ol |
| SMILES | CC[Si](CC)(CC)O[C@H]1CC=C(CC[C@H](O[Si](C)(C)C(C)(C)C)C2CCCCC2)[C@H]1CCCO |
| InChI | InChI=1S/C29H58O3Si2/c1-9-34(10-2,11-3)32-28-22-20-24(26(28)18-15-23-30)19-21-27(25-16-13-12-14-17-25)31-33(7,8)29(4,5)6/h20,25-28,30H,9-19,21-23H2,1-8H3/t26-,27+,28+/m1/s1 |
| InChIKey | ZHHDYDMEVPENEV-PKTNWEFCSA-N |
| XLogP | 8.85 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.95 |
| LogP ≤ 5 | 8.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|