C29H56O2Si2 — CID 18636628
tert-butyl-[(1S)-1-cyclohexyl-3-[(4S,5R)-5-prop-2-enyl-4-triethylsilyloxycyclopenten-1-yl]propoxy]-dimethylsilane (PubChem CID 18636628) has the molecular formula C29H56O2Si2 and a molecular weight of 492.94 g/mol. Its IUPAC name is tert-butyl-[(1S)-1-cyclohexyl-3-[(4S,5R)-5-prop-2-enyl-4-triethylsilyloxycyclopenten-1-yl]propoxy]-dimethylsilane.
| Compound Name | tert-butyl-[(1S)-1-cyclohexyl-3-[(4S,5R)-5-prop-2-enyl-4-triethylsilyloxycyclopenten-1-yl]propoxy]-dimethylsilane |
|---|---|
| PubChem CID | 18636628 |
| Molecular Formula | C29H56O2Si2 |
| Molecular Weight | 492.94 g/mol |
| Exact Mass | 492.38 |
| IUPAC Name | tert-butyl-[(1S)-1-cyclohexyl-3-[(4S,5R)-5-prop-2-enyl-4-triethylsilyloxycyclopenten-1-yl]propoxy]-dimethylsilane |
| SMILES | C=CC[C@@H]1C(CC[C@H](O[Si](C)(C)C(C)(C)C)C2CCCCC2)=CC[C@@H]1O[Si](CC)(CC)CC |
| InChI | InChI=1S/C29H56O2Si2/c1-10-17-26-24(21-23-28(26)31-33(11-2,12-3)13-4)20-22-27(25-18-15-14-16-19-25)30-32(8,9)29(5,6)7/h10,21,25-28H,1,11-20,22-23H2,2-9H3/t26-,27+,28+/m1/s1 |
| InChIKey | YIFGGKVZBMVBRY-PKTNWEFCSA-N |
| XLogP | 9.65 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.94 |
| LogP ≤ 5 | 9.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|