C23H42O4Si — CID 18636630
2-[(1R,5S)-2-[(3S)-3-[tert-butyl(dimethyl)silyl]oxy-3-cyclohexylbutyl]-5-hydroxycyclopent-2-en-1-yl]acetic acid (PubChem CID 18636630) has the molecular formula C23H42O4Si and a molecular weight of 410.67 g/mol. Its IUPAC name is 2-[(1R,5S)-2-[(3S)-3-[tert-butyl(dimethyl)silyl]oxy-3-cyclohexylbutyl]-5-hydroxycyclopent-2-en-1-yl]acetic acid.
| Compound Name | 2-[(1R,5S)-2-[(3S)-3-[tert-butyl(dimethyl)silyl]oxy-3-cyclohexylbutyl]-5-hydroxycyclopent-2-en-1-yl]acetic acid |
|---|---|
| PubChem CID | 18636630 |
| Molecular Formula | C23H42O4Si |
| Molecular Weight | 410.67 g/mol |
| Exact Mass | 410.29 |
| IUPAC Name | 2-[(1R,5S)-2-[(3S)-3-[tert-butyl(dimethyl)silyl]oxy-3-cyclohexylbutyl]-5-hydroxycyclopent-2-en-1-yl]acetic acid |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@](C)(CCC1=CC[C@H](O)[C@@H]1CC(=O)O)C1CCCCC1 |
| InChI | InChI=1S/C23H42O4Si/c1-22(2,3)28(5,6)27-23(4,18-10-8-7-9-11-18)15-14-17-12-13-20(24)19(17)16-21(25)26/h12,18-20,24H,7-11,13-16H2,1-6H3,(H,25,26)/t19-,20+,23+/m1/s1 |
| InChIKey | OAKWZDGWAKVDIY-QTEQDKRBSA-N |
| XLogP | 5.91 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.67 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|