C30H60O3Si2 — CID 18636631
3-[(1R,5S)-2-[(3S)-3-[tert-butyl(dimethyl)silyl]oxy-3-cyclohexylbutyl]-5-triethylsilyloxycyclopent-2-en-1-yl]propan-1-ol (PubChem CID 18636631) has the molecular formula C30H60O3Si2 and a molecular weight of 524.98 g/mol. Its IUPAC name is 3-[(1R,5S)-2-[(3S)-3-[tert-butyl(dimethyl)silyl]oxy-3-cyclohexylbutyl]-5-triethylsilyloxycyclopent-2-en-1-yl]propan-1-ol.
| Compound Name | 3-[(1R,5S)-2-[(3S)-3-[tert-butyl(dimethyl)silyl]oxy-3-cyclohexylbutyl]-5-triethylsilyloxycyclopent-2-en-1-yl]propan-1-ol |
|---|---|
| PubChem CID | 18636631 |
| Molecular Formula | C30H60O3Si2 |
| Molecular Weight | 524.98 g/mol |
| Exact Mass | 524.41 |
| IUPAC Name | 3-[(1R,5S)-2-[(3S)-3-[tert-butyl(dimethyl)silyl]oxy-3-cyclohexylbutyl]-5-triethylsilyloxycyclopent-2-en-1-yl]propan-1-ol |
| SMILES | CC[Si](CC)(CC)O[C@H]1CC=C(CC[C@](C)(O[Si](C)(C)C(C)(C)C)C2CCCCC2)[C@H]1CCCO |
| InChI | InChI=1S/C30H60O3Si2/c1-10-35(11-2,12-3)32-28-21-20-25(27(28)19-16-24-31)22-23-30(7,26-17-14-13-15-18-26)33-34(8,9)29(4,5)6/h20,26-28,31H,10-19,21-24H2,1-9H3/t27-,28+,30+/m1/s1 |
| InChIKey | FWRPLOQVSUXGAG-UNRZKBSHSA-N |
| XLogP | 9.24 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.98 |
| LogP ≤ 5 | 9.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|