C22H42O4Si — CID 18636634
2-[(1R,5S)-2-[(3S)-3-[tert-butyl(dimethyl)silyl]oxy-3-methyloctyl]-5-hydroxycyclopent-2-en-1-yl]acetic acid (PubChem CID 18636634) has the molecular formula C22H42O4Si and a molecular weight of 398.66 g/mol. Its IUPAC name is 2-[(1R,5S)-2-[(3S)-3-[tert-butyl(dimethyl)silyl]oxy-3-methyloctyl]-5-hydroxycyclopent-2-en-1-yl]acetic acid.
| Compound Name | 2-[(1R,5S)-2-[(3S)-3-[tert-butyl(dimethyl)silyl]oxy-3-methyloctyl]-5-hydroxycyclopent-2-en-1-yl]acetic acid |
|---|---|
| PubChem CID | 18636634 |
| Molecular Formula | C22H42O4Si |
| Molecular Weight | 398.66 g/mol |
| Exact Mass | 398.29 |
| IUPAC Name | 2-[(1R,5S)-2-[(3S)-3-[tert-butyl(dimethyl)silyl]oxy-3-methyloctyl]-5-hydroxycyclopent-2-en-1-yl]acetic acid |
| SMILES | CCCCC[C@@](C)(CCC1=CC[C@H](O)[C@@H]1CC(=O)O)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C22H42O4Si/c1-8-9-10-14-22(5,26-27(6,7)21(2,3)4)15-13-17-11-12-19(23)18(17)16-20(24)25/h11,18-19,23H,8-10,12-16H2,1-7H3,(H,24,25)/t18-,19+,22+/m1/s1 |
| InChIKey | GMBYCXUBLQUOLU-DXIQSLLYSA-N |
| XLogP | 5.91 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.66 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|